2-hexyldecanoic acid


2-hexyldecanoic acid; 2-n-hexyldecanoic acid
Links:📖 PubMed
CAS RN:[25354-97-6]
Formula:C16H32O2; 256.43 g/mol
InChiKey:JMOLZNNXZPAGBH-UHFFFAOYSA-N
SMILES:CCCCCCCCC(CCCCCC)C(O)=O
Molecular structure of 2-hexyldecanoic acid
Density:0.874 g/mL
Molar volume:293.4 mL/mol
Refractive index:1.446
Molecular refractive power:78.24 mL/mol
Melting point:10 °C
Boiling point:268 °C

Isomers

butyl dodecanoate
Molecular structure of butyl dodecanoate
ethyl tetradecanoate
Molecular structure of ethyl tetradecanoate
heptyl nonanoate
Molecular structure of heptyl nonanoate
hexadecanoic acid
Molecular structure of hexadecanoic acid
2-hexyldecanoic acid
Molecular structure of 2-hexyldecanoic acid
isobutyl dodecanoate
Molecular structure of isobutyl dodecanoate
methyl pentadecanoate
Molecular structure of methyl pentadecanoate
octyl octanoate
Molecular structure of octyl octanoate
tetradecyl acetate
Molecular structure of tetradecyl acetate